About 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline
1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline (PubChem CID 59512845) has the molecular formula C35H21F6N
and a molecular weight of 569.55 g/mol. Its IUPAC name is 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline.
Molecular Properties
| Compound Name | 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline |
| PubChem CID | 59512845 |
| Molecular Formula | C35H21F6N |
| Molecular Weight | 569.55 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline |
| SMILES | FC(F)(F)c1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)cc(-c3cccc(-c4nccc5ccccc45)c3)c2)cc1 |
| InChI | InChI=1S/C35H21F6N/c36-34(37,38)30-12-8-22(9-13-30)27-19-28(23-10-14-31(15-11-23)35(39,40)41)21-29(20-27)25-5-3-6-26(18-25)33-32-7-2-1-4-24(32)16-17-42-33/h1-21H |
| InChIKey | SCWXTDLRYHZNLR-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 569.55 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline?
The IUPAC name of 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline (CID 59512845) is 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline.
What is the SMILES notation for 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline?
The canonical SMILES for 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline is FC(F)(F)c1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)cc(-c3cccc(-c4nccc5ccccc45)c3)c2)cc1.
What is the InChIKey of 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline?
The InChIKey is SCWXTDLRYHZNLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H21F6N/c36-34(37,38)30-12-8-22(9-13-30)27-19-28(23-10-14-31(15-11-23)35(39,40)41)21-29(20-27)25-5-3-6-26(18-25)33-32-7-2-1-4-24(32)16-17-42-33/h1-21H.
What are the key properties of 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline?
1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline has a molecular weight of 569.55 g/mol, XLogP of 10.94, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]phenyl]isoquinoline is sourced from PubChem (CID 59512845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).