C63H45F13IrN- — CID 59512886
1-[3-[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-5-fluorobenzene-6-id-1-yl]-5-[3,5-bis(4-tert-butylphenyl)phenyl]isoquinoline;iridium (PubChem CID 59512886) has the molecular formula C63H45F13IrN- and a molecular weight of 1255.25 g/mol. Its IUPAC name is 1-[3-[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-5-fluorobenzene-6-id-1-yl]-5-[3,5-bis(4-tert-butylphenyl)phenyl]isoquinoline;iridium.
| Compound Name | 1-[3-[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-5-fluorobenzene-6-id-1-yl]-5-[3,5-bis(4-tert-butylphenyl)phenyl]isoquinoline;iridium |
|---|---|
| PubChem CID | 59512886 |
| Molecular Formula | C63H45F13IrN- |
| Molecular Weight | 1255.25 g/mol |
| Exact Mass | 1255.30 |
| IUPAC Name | 1-[3-[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-5-fluorobenzene-6-id-1-yl]-5-[3,5-bis(4-tert-butylphenyl)phenyl]isoquinoline;iridium |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cccc4c(-c5[c-]c(F)cc(-c6cc(-c7cc(C(F)(F)F)cc(C(F)(F)F)c7)cc(-c7cc(C(F)(F)F)cc(C(F)(F)F)c7)c6)c5)nccc34)c2)cc1.[Ir] |
| InChI | InChI=1S/C63H45F13N.Ir/c1-58(2,3)47-14-10-35(11-15-47)37-20-38(36-12-16-48(17-13-36)59(4,5)6)25-45(24-37)54-8-7-9-56-55(54)18-19-77-57(56)46-26-42(31-53(64)32-46)39-21-40(43-27-49(60(65,66)67)33-50(28-43)61(68,69)70)23-41(22-39)44-29-51(62(71,72)73)34-52(30-44)63(74,75)76;/h7-31,33-34H,1-6H3;/q-1; |
| InChIKey | FRKDWVFBVACNNC-UHFFFAOYSA-N |
| XLogP | 20.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1255.25 |
| LogP ≤ 5 | 20.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|