C44H36FNO — CID 59512916
1-[3-[3,5-bis(4-ethylphenyl)phenyl]-5-fluorophenyl]-5-(4-methoxyphenyl)isoquinoline (PubChem CID 59512916) has the molecular formula C44H36FNO and a molecular weight of 613.78 g/mol. Its IUPAC name is 1-[3-[3,5-bis(4-ethylphenyl)phenyl]-5-fluorophenyl]-5-(4-methoxyphenyl)isoquinoline.
| Compound Name | 1-[3-[3,5-bis(4-ethylphenyl)phenyl]-5-fluorophenyl]-5-(4-methoxyphenyl)isoquinoline |
|---|---|
| PubChem CID | 59512916 |
| Molecular Formula | C44H36FNO |
| Molecular Weight | 613.78 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | 1-[3-[3,5-bis(4-ethylphenyl)phenyl]-5-fluorophenyl]-5-(4-methoxyphenyl)isoquinoline |
| SMILES | CCc1ccc(-c2cc(-c3ccc(CC)cc3)cc(-c3cc(F)cc(-c4nccc5c(-c6ccc(OC)cc6)cccc45)c3)c2)cc1 |
| InChI | InChI=1S/C44H36FNO/c1-4-29-9-13-31(14-10-29)34-23-35(32-15-11-30(5-2)12-16-32)25-36(24-34)37-26-38(28-39(45)27-37)44-43-8-6-7-41(42(43)21-22-46-44)33-17-19-40(47-3)20-18-33/h6-28H,4-5H2,1-3H3 |
| InChIKey | UYAGJMHJGBTPBB-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.78 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |