C9H10N2O4 — CID 59513093
(2S)-2-[(3-hydroxypyridine-2-carbonyl)amino]propanoic acid (PubChem CID 59513093) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is (2S)-2-[(3-hydroxypyridine-2-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(3-hydroxypyridine-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 59513093 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (2S)-2-[(3-hydroxypyridine-2-carbonyl)amino]propanoic acid |
| SMILES | C[C@H](NC(=O)c1ncccc1O)C(=O)O |
| InChI | InChI=1S/C9H10N2O4/c1-5(9(14)15)11-8(13)7-6(12)3-2-4-10-7/h2-5,12H,1H3,(H,11,13)(H,14,15)/t5-/m0/s1 |
| InChIKey | IEBAZSSCDQTWSX-YFKPBYRVSA-N |
| XLogP | -0.01 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |