C10H13ClN2 — CID 59514064
6-chloro-1,3,7-trimethyl-3a,7a-dihydroindazole (PubChem CID 59514064) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is 6-chloro-1,3,7-trimethyl-3a,7a-dihydroindazole.
| Compound Name | 6-chloro-1,3,7-trimethyl-3a,7a-dihydroindazole |
|---|---|
| PubChem CID | 59514064 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 6-chloro-1,3,7-trimethyl-3a,7a-dihydroindazole |
| SMILES | CC1=NN(C)C2C(C)=C(Cl)C=CC12 |
| InChI | InChI=1S/C10H13ClN2/c1-6-9(11)5-4-8-7(2)12-13(3)10(6)8/h4-5,8,10H,1-3H3 |
| InChIKey | VSQRZLDDDXEETE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |