About 6-chloro-2,3,7-trimethylindazole
6-chloro-2,3,7-trimethylindazole (PubChem CID 59514075) has the molecular formula C10H11ClN2
and a molecular weight of 194.66 g/mol. Its IUPAC name is 6-chloro-2,3,7-trimethylindazole.
Molecular Properties
| Compound Name | 6-chloro-2,3,7-trimethylindazole |
| PubChem CID | 59514075 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 6-chloro-2,3,7-trimethylindazole |
| SMILES | Cc1c(Cl)ccc2c(C)n(C)nc12 |
| InChI | InChI=1S/C10H11ClN2/c1-6-9(11)5-4-8-7(2)13(3)12-10(6)8/h4-5H,1-3H3 |
| InChIKey | ICOFCICFXKXECV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-2,3,7-trimethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,3,7-trimethylindazole?
The IUPAC name of 6-chloro-2,3,7-trimethylindazole (CID 59514075) is 6-chloro-2,3,7-trimethylindazole.
What is the SMILES notation for 6-chloro-2,3,7-trimethylindazole?
The canonical SMILES for 6-chloro-2,3,7-trimethylindazole is Cc1c(Cl)ccc2c(C)n(C)nc12.
What is the InChIKey of 6-chloro-2,3,7-trimethylindazole?
The InChIKey is ICOFCICFXKXECV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2/c1-6-9(11)5-4-8-7(2)13(3)12-10(6)8/h4-5H,1-3H3.
What are the key properties of 6-chloro-2,3,7-trimethylindazole?
6-chloro-2,3,7-trimethylindazole has a molecular weight of 194.66 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,3,7-trimethylindazole is sourced from PubChem (CID 59514075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).