C22H11F10N3 — CID 59514076
1-methyl-N,N-bis[(2,3,4,5,6-pentafluorophenyl)methyl]indazol-5-amine (PubChem CID 59514076) has the molecular formula C22H11F10N3 and a molecular weight of 507.33 g/mol. Its IUPAC name is 1-methyl-N,N-bis[(2,3,4,5,6-pentafluorophenyl)methyl]indazol-5-amine.
| Compound Name | 1-methyl-N,N-bis[(2,3,4,5,6-pentafluorophenyl)methyl]indazol-5-amine |
|---|---|
| PubChem CID | 59514076 |
| Molecular Formula | C22H11F10N3 |
| Molecular Weight | 507.33 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 1-methyl-N,N-bis[(2,3,4,5,6-pentafluorophenyl)methyl]indazol-5-amine |
| SMILES | Cn1ncc2cc(N(Cc3c(F)c(F)c(F)c(F)c3F)Cc3c(F)c(F)c(F)c(F)c3F)ccc21 |
| InChI | InChI=1S/C22H11F10N3/c1-34-12-3-2-9(4-8(12)5-33-34)35(6-10-13(23)17(27)21(31)18(28)14(10)24)7-11-15(25)19(29)22(32)20(30)16(11)26/h2-5H,6-7H2,1H3 |
| InChIKey | HBNYPTJWHQOPGW-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.33 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|