C32H30N2O2S4 — CID 59514681
2,5-bis[5-(4-butoxyphenyl)thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 59514681) has the molecular formula C32H30N2O2S4 and a molecular weight of 602.87 g/mol. Its IUPAC name is 2,5-bis[5-(4-butoxyphenyl)thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | 2,5-bis[5-(4-butoxyphenyl)thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 59514681 |
| Molecular Formula | C32H30N2O2S4 |
| Molecular Weight | 602.87 g/mol |
| Exact Mass | 602.12 |
| IUPAC Name | 2,5-bis[5-(4-butoxyphenyl)thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | CCCCOc1ccc(-c2ccc(-c3nc4sc(-c5ccc(-c6ccc(OCCCC)cc6)s5)nc4s3)s2)cc1 |
| InChI | InChI=1S/C32H30N2O2S4/c1-3-5-19-35-23-11-7-21(8-12-23)25-15-17-27(37-25)29-33-31-32(39-29)34-30(40-31)28-18-16-26(38-28)22-9-13-24(14-10-22)36-20-6-4-2/h7-18H,3-6,19-20H2,1-2H3 |
| InChIKey | ICFARZBAUPSNMN-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.87 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|