C20H15ClN2O4 — CID 59514758
5-chloro-1-[(3S,4R)-3-hydroxy-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]indole-2,3-dione (PubChem CID 59514758) has the molecular formula C20H15ClN2O4 and a molecular weight of 382.80 g/mol. Its IUPAC name is 5-chloro-1-[(3S,4R)-3-hydroxy-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[(3S,4R)-3-hydroxy-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]indole-2,3-dione |
|---|---|
| PubChem CID | 59514758 |
| Molecular Formula | C20H15ClN2O4 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 5-chloro-1-[(3S,4R)-3-hydroxy-6-isocyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]indole-2,3-dione |
| SMILES | [C-]#[N+]c1ccc2c(c1)[C@@H](N1C(=O)C(=O)c3cc(Cl)ccc31)[C@H](O)C(C)(C)O2 |
| InChI | InChI=1S/C20H15ClN2O4/c1-20(2)18(25)16(13-9-11(22-3)5-7-15(13)27-20)23-14-6-4-10(21)8-12(14)17(24)19(23)26/h4-9,16,18,25H,1-2H3/t16-,18+/m1/s1 |
| InChIKey | DWZWIVHUAIFUMA-AEFFLSMTSA-N |
| XLogP | 3.69 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|