C10H3F13N2O2 — CID 595148
5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidine-2,4-dione (PubChem CID 595148) has the molecular formula C10H3F13N2O2 and a molecular weight of 430.12 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 595148 |
| Molecular Formula | C10H3F13N2O2 |
| Molecular Weight | 430.12 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C10H3F13N2O2/c11-5(12,2-1-24-4(27)25-3(2)26)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h1H,(H2,24,25,26,27) |
| InChIKey | PLCJTKJJJMWPBA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.12 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|