C22H19N3O3 — CID 59514816
(3S,4R)-6-isocyano-2,2-dimethyl-4-(6-phenylpyridazin-3-yl)oxy-3,4-dihydrochromen-3-ol (PubChem CID 59514816) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is (3S,4R)-6-isocyano-2,2-dimethyl-4-(6-phenylpyridazin-3-yl)oxy-3,4-dihydrochromen-3-ol.
| Compound Name | (3S,4R)-6-isocyano-2,2-dimethyl-4-(6-phenylpyridazin-3-yl)oxy-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 59514816 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (3S,4R)-6-isocyano-2,2-dimethyl-4-(6-phenylpyridazin-3-yl)oxy-3,4-dihydrochromen-3-ol |
| SMILES | [C-]#[N+]c1ccc2c(c1)[C@@H](Oc1ccc(-c3ccccc3)nn1)[C@H](O)C(C)(C)O2 |
| InChI | InChI=1S/C22H19N3O3/c1-22(2)21(26)20(16-13-15(23-3)9-11-18(16)28-22)27-19-12-10-17(24-25-19)14-7-5-4-6-8-14/h4-13,20-21,26H,1-2H3/t20-,21+/m1/s1 |
| InChIKey | BACQTHBHYXOSSO-RTWAWAEBSA-N |
| XLogP | 4.35 |
| TPSA | 68.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|