C17H34O2 — CID 59514850
7-hydroxy-2,2,12,12-tetramethyltridecanal (PubChem CID 59514850) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is 7-hydroxy-2,2,12,12-tetramethyltridecanal.
| Compound Name | 7-hydroxy-2,2,12,12-tetramethyltridecanal |
|---|---|
| PubChem CID | 59514850 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 7-hydroxy-2,2,12,12-tetramethyltridecanal |
| SMILES | CC(C)(C)CCCCC(O)CCCCC(C)(C)C=O |
| InChI | InChI=1S/C17H34O2/c1-16(2,3)12-8-6-10-15(19)11-7-9-13-17(4,5)14-18/h14-15,19H,6-13H2,1-5H3 |
| InChIKey | URKLYWRAZWMIBN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|