C7H3F7N2O2 — CID 595149
5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrimidine-2,4-dione (PubChem CID 595149) has the molecular formula C7H3F7N2O2 and a molecular weight of 280.10 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 595149 |
| Molecular Formula | C7H3F7N2O2 |
| Molecular Weight | 280.10 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(C(F)(F)C(F)(F)C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C7H3F7N2O2/c8-5(9,6(10,11)7(12,13)14)2-1-15-4(18)16-3(2)17/h1H,(H2,15,16,17,18) |
| InChIKey | HFWQHAOXBQBFQJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.10 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|