About prop-1-en-2-ylhydrazine
prop-1-en-2-ylhydrazine (PubChem CID 59514914) has the molecular formula C3H8N2
and a molecular weight of 72.11 g/mol. Its IUPAC name is prop-1-en-2-ylhydrazine.
Molecular Properties
| Compound Name | prop-1-en-2-ylhydrazine |
| PubChem CID | 59514914 |
| Molecular Formula | C3H8N2 |
| Molecular Weight | 72.11 g/mol |
| Exact Mass | 72.07 |
| IUPAC Name | prop-1-en-2-ylhydrazine |
| SMILES | C=C(C)NN |
| InChI | InChI=1S/C3H8N2/c1-3(2)5-4/h5H,1,4H2,2H3 |
| InChIKey | VDISOPOFZZJVTJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 72.11 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-ylhydrazine?
The IUPAC name of prop-1-en-2-ylhydrazine (CID 59514914) is prop-1-en-2-ylhydrazine.
What is the SMILES notation for prop-1-en-2-ylhydrazine?
The canonical SMILES for prop-1-en-2-ylhydrazine is C=C(C)NN.
What is the InChIKey of prop-1-en-2-ylhydrazine?
The InChIKey is VDISOPOFZZJVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2/c1-3(2)5-4/h5H,1,4H2,2H3.
What are the key properties of prop-1-en-2-ylhydrazine?
prop-1-en-2-ylhydrazine has a molecular weight of 72.11 g/mol, XLogP of -0.02, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-ylhydrazine is sourced from PubChem (CID 59514914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).