About 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one
3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one (PubChem CID 59514944) has the molecular formula C10H18O5S
and a molecular weight of 250.32 g/mol. Its IUPAC name is 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one.
Molecular Properties
| Compound Name | 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one |
| PubChem CID | 59514944 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one |
| SMILES | CSCCC1(O)OCC(C)(CO)COC1=O |
| InChI | InChI=1S/C10H18O5S/c1-9(5-11)6-14-8(12)10(13,15-7-9)3-4-16-2/h11,13H,3-7H2,1-2H3 |
| InChIKey | NXANPGDXQUQFOX-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one?
The IUPAC name of 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one (CID 59514944) is 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one.
What is the SMILES notation for 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one?
The canonical SMILES for 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one is CSCCC1(O)OCC(C)(CO)COC1=O.
What is the InChIKey of 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one?
The InChIKey is NXANPGDXQUQFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5S/c1-9(5-11)6-14-8(12)10(13,15-7-9)3-4-16-2/h11,13H,3-7H2,1-2H3.
What are the key properties of 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one?
3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one has a molecular weight of 250.32 g/mol, XLogP of 0.00, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-6-(hydroxymethyl)-6-methyl-3-(2-methylsulfanylethyl)-1,4-dioxepan-2-one is sourced from PubChem (CID 59514944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).