C50H46N2 — CID 59514966
6-N,6-N,12-N,12-N-tetrakis(3,4-dimethylphenyl)chrysene-6,12-diamine (PubChem CID 59514966) has the molecular formula C50H46N2 and a molecular weight of 674.93 g/mol. Its IUPAC name is 6-N,6-N,12-N,12-N-tetrakis(3,4-dimethylphenyl)chrysene-6,12-diamine.
| Compound Name | 6-N,6-N,12-N,12-N-tetrakis(3,4-dimethylphenyl)chrysene-6,12-diamine |
|---|---|
| PubChem CID | 59514966 |
| Molecular Formula | C50H46N2 |
| Molecular Weight | 674.93 g/mol |
| Exact Mass | 674.37 |
| IUPAC Name | 6-N,6-N,12-N,12-N-tetrakis(3,4-dimethylphenyl)chrysene-6,12-diamine |
| SMILES | Cc1ccc(N(c2ccc(C)c(C)c2)c2cc3c4ccccc4c(N(c4ccc(C)c(C)c4)c4ccc(C)c(C)c4)cc3c3ccccc23)cc1C |
| InChI | InChI=1S/C50H46N2/c1-31-17-21-39(25-35(31)5)51(40-22-18-32(2)36(6)26-40)49-29-47-44-14-10-12-16-46(44)50(30-48(47)43-13-9-11-15-45(43)49)52(41-23-19-33(3)37(7)27-41)42-24-20-34(4)38(8)28-42/h9-30H,1-8H3 |
| InChIKey | SIEYGCOROKCHEO-UHFFFAOYSA-N |
| XLogP | 14.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.93 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|