C16H21BO6 — CID 59515287
ethyl 2-[2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-formylphenoxy]acetate (PubChem CID 59515287) has the molecular formula C16H21BO6 and a molecular weight of 320.15 g/mol. Its IUPAC name is ethyl 2-[2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-formylphenoxy]acetate.
| Compound Name | ethyl 2-[2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-formylphenoxy]acetate |
|---|---|
| PubChem CID | 59515287 |
| Molecular Formula | C16H21BO6 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | ethyl 2-[2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-formylphenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(C=O)c1B1OCC(C)(C)CO1 |
| InChI | InChI=1S/C16H21BO6/c1-4-20-14(19)9-21-13-7-5-6-12(8-18)15(13)17-22-10-16(2,3)11-23-17/h5-8H,4,9-11H2,1-3H3 |
| InChIKey | SEIPKGVFYWOAEG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|