C19H27BO6 — CID 59515301
3-(oxan-2-yloxymethoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (PubChem CID 59515301) has the molecular formula C19H27BO6 and a molecular weight of 362.23 g/mol. Its IUPAC name is 3-(oxan-2-yloxymethoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
| Compound Name | 3-(oxan-2-yloxymethoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 59515301 |
| Molecular Formula | C19H27BO6 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 3-(oxan-2-yloxymethoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| SMILES | CC1(C)OB(c2c(C=O)cccc2OCOC2CCCCO2)OC1(C)C |
| InChI | InChI=1S/C19H27BO6/c1-18(2)19(3,4)26-20(25-18)17-14(12-21)8-7-9-15(17)23-13-24-16-10-5-6-11-22-16/h7-9,12,16H,5-6,10-11,13H2,1-4H3 |
| InChIKey | WTUZYDIUXAPGEJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|