About (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol
(1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol (PubChem CID 59515457) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol.
Molecular Properties
| Compound Name | (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol |
| PubChem CID | 59515457 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol |
| SMILES | NC[C@H](O)C1C=CC=CC1 |
| InChI | InChI=1S/C8H13NO/c9-6-8(10)7-4-2-1-3-5-7/h1-4,7-8,10H,5-6,9H2/t7?,8-/m0/s1 |
| InChIKey | VPTLVPMAWIREJW-MQWKRIRWSA-N |
| XLogP | 0.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol?
The IUPAC name of (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol (CID 59515457) is (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol.
What is the SMILES notation for (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol?
The canonical SMILES for (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol is NC[C@H](O)C1C=CC=CC1.
What is the InChIKey of (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol?
The InChIKey is VPTLVPMAWIREJW-MQWKRIRWSA-N. The full InChI is InChI=1S/C8H13NO/c9-6-8(10)7-4-2-1-3-5-7/h1-4,7-8,10H,5-6,9H2/t7?,8-/m0/s1.
What are the key properties of (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol?
(1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol has a molecular weight of 139.20 g/mol, XLogP of 0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-amino-1-cyclohexa-2,4-dien-1-ylethanol is sourced from PubChem (CID 59515457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).