C21H15ClF3N5O — CID 59515627
N-[3-(6-amino-1H-benzimidazol-2-yl)-4-chlorophenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 59515627) has the molecular formula C21H15ClF3N5O and a molecular weight of 445.83 g/mol. Its IUPAC name is N-[3-(6-amino-1H-benzimidazol-2-yl)-4-chlorophenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-(6-amino-1H-benzimidazol-2-yl)-4-chlorophenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59515627 |
| Molecular Formula | C21H15ClF3N5O |
| Molecular Weight | 445.83 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-[3-(6-amino-1H-benzimidazol-2-yl)-4-chlorophenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Cc1nc(C(F)(F)F)ccc1C(=O)Nc1ccc(Cl)c(-c2nc3ccc(N)cc3[nH]2)c1 |
| InChI | InChI=1S/C21H15ClF3N5O/c1-10-13(4-7-18(27-10)21(23,24)25)20(31)28-12-3-5-15(22)14(9-12)19-29-16-6-2-11(26)8-17(16)30-19/h2-9H,26H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | PCMLAVPCSQFWDY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.83 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|