C31H42O5S2 — CID 59516022
[(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(acetylsulfanylmethyl)phenyl]sulfanylacetate (PubChem CID 59516022) has the molecular formula C31H42O5S2 and a molecular weight of 558.81 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(acetylsulfanylmethyl)phenyl]sulfanylacetate.
| Compound Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(acetylsulfanylmethyl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 59516022 |
| Molecular Formula | C31H42O5S2 |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(acetylsulfanylmethyl)phenyl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2cccc(CSC(C)=O)c2)[C@]2(C)C(C)CCC3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C31H42O5S2/c1-7-29(5)16-25(36-26(34)18-38-23-10-8-9-22(15-23)17-37-21(4)32)30(6)19(2)11-13-31(20(3)28(29)35)14-12-24(33)27(30)31/h7-10,15,19-20,25,27-28,35H,1,11-14,16-18H2,2-6H3/t19?,20-,25+,27?,28-,29+,30-,31?/m0/s1 |
| InChIKey | CWPVKIAAUFUJGX-UQDWVGMNSA-N |
| XLogP | 6.46 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|