C29H40O4S2 — CID 59516032
[(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(sulfanylmethyl)phenyl]sulfanylacetate (PubChem CID 59516032) has the molecular formula C29H40O4S2 and a molecular weight of 516.77 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(sulfanylmethyl)phenyl]sulfanylacetate.
| Compound Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(sulfanylmethyl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 59516032 |
| Molecular Formula | C29H40O4S2 |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(sulfanylmethyl)phenyl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2cccc(CS)c2)[C@]2(C)C(C)CCC3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C29H40O4S2/c1-6-27(4)15-23(33-24(31)17-35-21-9-7-8-20(14-21)16-34)28(5)18(2)10-12-29(19(3)26(27)32)13-11-22(30)25(28)29/h6-9,14,18-19,23,25-26,32,34H,1,10-13,15-17H2,2-5H3/t18?,19-,23+,25?,26-,27+,28-,29?/m0/s1 |
| InChIKey | WIPMDXAZCWOGKA-VENPPMLCSA-N |
| XLogP | 6.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|