C48H54O4S2 — CID 59516034
[(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(tritylsulfanylmethyl)phenyl]sulfanylacetate (PubChem CID 59516034) has the molecular formula C48H54O4S2 and a molecular weight of 759.09 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(tritylsulfanylmethyl)phenyl]sulfanylacetate.
| Compound Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(tritylsulfanylmethyl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 59516034 |
| Molecular Formula | C48H54O4S2 |
| Molecular Weight | 759.09 g/mol |
| Exact Mass | 758.35 |
| IUPAC Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-(tritylsulfanylmethyl)phenyl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2cccc(CSC(c3ccccc3)(c3ccccc3)c3ccccc3)c2)[C@]2(C)C(C)CCC3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C48H54O4S2/c1-6-45(4)30-41(46(5)33(2)25-27-47(34(3)44(45)51)28-26-40(49)43(46)47)52-42(50)32-53-39-24-16-17-35(29-39)31-54-48(36-18-10-7-11-19-36,37-20-12-8-13-21-37)38-22-14-9-15-23-38/h6-24,29,33-34,41,43-44,51H,1,25-28,30-32H2,2-5H3/t33?,34-,41+,43?,44-,45+,46-,47?/m0/s1 |
| InChIKey | KATLWNOSRJRTNG-ZTTOWEIZSA-N |
| XLogP | 10.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.09 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|