C20H39N3O — CID 59516358
2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]guanidine (PubChem CID 59516358) has the molecular formula C20H39N3O and a molecular weight of 337.55 g/mol. Its IUPAC name is 2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]guanidine.
| Compound Name | 2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]guanidine |
|---|---|
| PubChem CID | 59516358 |
| Molecular Formula | C20H39N3O |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.31 |
| IUPAC Name | 2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]guanidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCON/C(N)=N/C |
| InChI | InChI=1S/C20H39N3O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-23-20(21)22-2/h7-8,10-11H,3-6,9,12-19H2,1-2H3,(H3,21,22,23)/b8-7-,11-10- |
| InChIKey | CERMGKFSDKSWOP-NQLNTKRDSA-N |
| XLogP | 5.27 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|