C17H12N2O3S2 — CID 59516504
ethyl 5-oxo-3-sulfanyl-[1,3]benzothiazolo[3,2-a][1,8]naphthyridine-6-carboxylate (PubChem CID 59516504) has the molecular formula C17H12N2O3S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is ethyl 5-oxo-3-sulfanyl-[1,3]benzothiazolo[3,2-a][1,8]naphthyridine-6-carboxylate.
| Compound Name | ethyl 5-oxo-3-sulfanyl-[1,3]benzothiazolo[3,2-a][1,8]naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 59516504 |
| Molecular Formula | C17H12N2O3S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | ethyl 5-oxo-3-sulfanyl-[1,3]benzothiazolo[3,2-a][1,8]naphthyridine-6-carboxylate |
| SMILES | CCOC(=O)c1c(=O)c2cc(S)cnc2n2c1sc1ccccc12 |
| InChI | InChI=1S/C17H12N2O3S2/c1-2-22-17(21)13-14(20)10-7-9(23)8-18-15(10)19-11-5-3-4-6-12(11)24-16(13)19/h3-8,23H,2H2,1H3 |
| InChIKey | OFVISQDRWZFAIM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 60.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|