C17H13N3O3S2 — CID 59516512
ethyl 4-methylsulfanyl-8-oxo-11-thia-1,3,5-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaene-9-carboxylate (PubChem CID 59516512) has the molecular formula C17H13N3O3S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is ethyl 4-methylsulfanyl-8-oxo-11-thia-1,3,5-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaene-9-carboxylate.
| Compound Name | ethyl 4-methylsulfanyl-8-oxo-11-thia-1,3,5-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaene-9-carboxylate |
|---|---|
| PubChem CID | 59516512 |
| Molecular Formula | C17H13N3O3S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | ethyl 4-methylsulfanyl-8-oxo-11-thia-1,3,5-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaene-9-carboxylate |
| SMILES | CCOC(=O)c1c(=O)c2cnc(SC)nc2n2c1sc1ccccc12 |
| InChI | InChI=1S/C17H13N3O3S2/c1-3-23-16(22)12-13(21)9-8-18-17(24-2)19-14(9)20-10-6-4-5-7-11(10)25-15(12)20/h4-8H,3H2,1-2H3 |
| InChIKey | HHPQLZGRNCDFFN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |