C40H32N6O4 — CID 59516800
3-[4-[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]phenyl]-5,6-bis(4-methoxyphenyl)-1,2,4-triazine (PubChem CID 59516800) has the molecular formula C40H32N6O4 and a molecular weight of 660.73 g/mol. Its IUPAC name is 3-[4-[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]phenyl]-5,6-bis(4-methoxyphenyl)-1,2,4-triazine.
| Compound Name | 3-[4-[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]phenyl]-5,6-bis(4-methoxyphenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 59516800 |
| Molecular Formula | C40H32N6O4 |
| Molecular Weight | 660.73 g/mol |
| Exact Mass | 660.25 |
| IUPAC Name | 3-[4-[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]phenyl]-5,6-bis(4-methoxyphenyl)-1,2,4-triazine |
| SMILES | COc1ccc(-c2nnc(-c3ccc(-c4nnc(-c5ccc(OC)cc5)c(-c5ccc(OC)cc5)n4)cc3)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H32N6O4/c1-47-31-17-9-25(10-18-31)35-37(27-13-21-33(49-3)22-14-27)43-45-39(41-35)29-5-7-30(8-6-29)40-42-36(26-11-19-32(48-2)20-12-26)38(44-46-40)28-15-23-34(50-4)24-16-28/h5-24H,1-4H3 |
| InChIKey | CTMNESMOIQAHAJ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.73 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |