C21H18FN3O5S — CID 59516862
methyl (1Z)-2-(4-cyanophenyl)imino-2-(5-fluoro-8-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-N-methoxycarbonylethanimidothioate (PubChem CID 59516862) has the molecular formula C21H18FN3O5S and a molecular weight of 443.46 g/mol. Its IUPAC name is methyl (1Z)-2-(4-cyanophenyl)imino-2-(5-fluoro-8-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-N-methoxycarbonylethanimidothioate.
| Compound Name | methyl (1Z)-2-(4-cyanophenyl)imino-2-(5-fluoro-8-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-N-methoxycarbonylethanimidothioate |
|---|---|
| PubChem CID | 59516862 |
| Molecular Formula | C21H18FN3O5S |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | methyl (1Z)-2-(4-cyanophenyl)imino-2-(5-fluoro-8-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)-N-methoxycarbonylethanimidothioate |
| SMILES | COC(=O)/N=C(SC)/C(=N\c1ccc(C#N)cc1)c1cc(OC)c2c(c1F)OCCO2 |
| InChI | InChI=1S/C21H18FN3O5S/c1-27-15-10-14(16(22)19-18(15)29-8-9-30-19)17(20(31-3)25-21(26)28-2)24-13-6-4-12(11-23)5-7-13/h4-7,10H,8-9H2,1-3H3/b24-17-,25-20- |
| InChIKey | SUYVGWCVYMTSKH-SLPUAWSHSA-N |
| XLogP | 4.13 |
| TPSA | 102.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|