About 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile
4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile (PubChem CID 59517247) has the molecular formula C17H14FN3O2
and a molecular weight of 311.32 g/mol. Its IUPAC name is 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile |
| PubChem CID | 59517247 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile |
| SMILES | COc1cc(OC)c(F)c(C(C#N)Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C17H14FN3O2/c1-22-13-7-14(17(18)16(8-13)23-2)15(10-20)21-12-5-3-11(9-19)4-6-12/h3-8,15,21H,1-2H3 |
| InChIKey | NBBJSPMNEGDCKK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile?
The IUPAC name of 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile (CID 59517247) is 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile.
What is the SMILES notation for 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile?
The canonical SMILES for 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile is COc1cc(OC)c(F)c(C(C#N)Nc2ccc(C#N)cc2)c1.
What is the InChIKey of 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile?
The InChIKey is NBBJSPMNEGDCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN3O2/c1-22-13-7-14(17(18)16(8-13)23-2)15(10-20)21-12-5-3-11(9-19)4-6-12/h3-8,15,21H,1-2H3.
What are the key properties of 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile?
4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile has a molecular weight of 311.32 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]benzonitrile is sourced from PubChem (CID 59517247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).