About 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid
6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid (PubChem CID 59517879) has the molecular formula C31H25N3O3
and a molecular weight of 487.56 g/mol. Its IUPAC name is 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid |
| PubChem CID | 59517879 |
| Molecular Formula | C31H25N3O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(OC(Cc2cccc(-c3ccccn3)c2)Cc2cccc(-c3ccccn3)c2)n1 |
| InChI | InChI=1S/C31H25N3O3/c35-31(36)29-14-7-15-30(34-29)37-26(20-22-8-5-10-24(18-22)27-12-1-3-16-32-27)21-23-9-6-11-25(19-23)28-13-2-4-17-33-28/h1-19,26H,20-21H2,(H,35,36) |
| InChIKey | GOJUWBMKHPGBBP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid?
The IUPAC name of 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid (CID 59517879) is 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid?
The canonical SMILES for 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid is O=C(O)c1cccc(OC(Cc2cccc(-c3ccccn3)c2)Cc2cccc(-c3ccccn3)c2)n1.
What is the InChIKey of 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid?
The InChIKey is GOJUWBMKHPGBBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H25N3O3/c35-31(36)29-14-7-15-30(34-29)37-26(20-22-8-5-10-24(18-22)27-12-1-3-16-32-27)21-23-9-6-11-25(19-23)28-13-2-4-17-33-28/h1-19,26H,20-21H2,(H,35,36).
What are the key properties of 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid?
6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid has a molecular weight of 487.56 g/mol, XLogP of 6.14, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1,3-bis(3-pyridin-2-ylphenyl)propan-2-yloxy]pyridine-2-carboxylic acid is sourced from PubChem (CID 59517879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).