C21H32N4O4 — CID 59517977
1-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]-N-[(1R)-1-hydroxy-2-phenylethyl]pyrrolidine-2-carboxamide (PubChem CID 59517977) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]-N-[(1R)-1-hydroxy-2-phenylethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]-N-[(1R)-1-hydroxy-2-phenylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59517977 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 1-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]-N-[(1R)-1-hydroxy-2-phenylethyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C)N)C(=O)N1CCCC1C(=O)N[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C21H32N4O4/c1-13(2)18(24-19(27)14(3)22)21(29)25-11-7-10-16(25)20(28)23-17(26)12-15-8-5-4-6-9-15/h4-6,8-9,13-14,16-18,26H,7,10-12,22H2,1-3H3,(H,23,28)(H,24,27)/t14-,16?,17+,18-/m0/s1 |
| InChIKey | PABHDRYKSZAIRA-QVSBOGRUSA-N |
| XLogP | 0.14 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|