C11H14Cl2O3 — CID 59518478
2-(2,2-dichloroacetyl)-3-hydroxy-4,4,6-trimethylcyclohex-2-en-1-one (PubChem CID 59518478) has the molecular formula C11H14Cl2O3 and a molecular weight of 265.14 g/mol. Its IUPAC name is 2-(2,2-dichloroacetyl)-3-hydroxy-4,4,6-trimethylcyclohex-2-en-1-one.
| Compound Name | 2-(2,2-dichloroacetyl)-3-hydroxy-4,4,6-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 59518478 |
| Molecular Formula | C11H14Cl2O3 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-(2,2-dichloroacetyl)-3-hydroxy-4,4,6-trimethylcyclohex-2-en-1-one |
| SMILES | CC1CC(C)(C)C(O)=C(C(=O)C(Cl)Cl)C1=O |
| InChI | InChI=1S/C11H14Cl2O3/c1-5-4-11(2,3)9(16)6(7(5)14)8(15)10(12)13/h5,10,16H,4H2,1-3H3 |
| InChIKey | PGYOENASVYVZPV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|