C32H34N4O3 — CID 59518860
2-[3-[[(1R)-1-(1-benzyl-4-phenylimidazol-2-yl)-2,2-dimethylpropyl]amino]-2-hydroxypropyl]isoindole-1,3-dione (PubChem CID 59518860) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is 2-[3-[[(1R)-1-(1-benzyl-4-phenylimidazol-2-yl)-2,2-dimethylpropyl]amino]-2-hydroxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[[(1R)-1-(1-benzyl-4-phenylimidazol-2-yl)-2,2-dimethylpropyl]amino]-2-hydroxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59518860 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 2-[3-[[(1R)-1-(1-benzyl-4-phenylimidazol-2-yl)-2,2-dimethylpropyl]amino]-2-hydroxypropyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)[C@@H](NCC(O)CN1C(=O)c2ccccc2C1=O)c1nc(-c2ccccc2)cn1Cc1ccccc1 |
| InChI | InChI=1S/C32H34N4O3/c1-32(2,3)28(33-18-24(37)20-36-30(38)25-16-10-11-17-26(25)31(36)39)29-34-27(23-14-8-5-9-15-23)21-35(29)19-22-12-6-4-7-13-22/h4-17,21,24,28,33,37H,18-20H2,1-3H3/t24?,28-/m0/s1 |
| InChIKey | JTHDUROPMSBOKE-AZKKKJBWSA-N |
| XLogP | 4.93 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|