C27H32ClFN6O2 — CID 59518872
N-[(2S)-3-azido-2-hydroxypropyl]-N-[(1R)-1-[1-benzyl-4-(3-fluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]-2-chloropropanamide (PubChem CID 59518872) has the molecular formula C27H32ClFN6O2 and a molecular weight of 527.04 g/mol. Its IUPAC name is N-[(2S)-3-azido-2-hydroxypropyl]-N-[(1R)-1-[1-benzyl-4-(3-fluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]-2-chloropropanamide.
| Compound Name | N-[(2S)-3-azido-2-hydroxypropyl]-N-[(1R)-1-[1-benzyl-4-(3-fluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]-2-chloropropanamide |
|---|---|
| PubChem CID | 59518872 |
| Molecular Formula | C27H32ClFN6O2 |
| Molecular Weight | 527.04 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | N-[(2S)-3-azido-2-hydroxypropyl]-N-[(1R)-1-[1-benzyl-4-(3-fluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]-2-chloropropanamide |
| SMILES | CC(Cl)C(=O)N(C[C@H](O)CN=[N+]=[N-])[C@@H](c1nc(-c2cccc(F)c2)cn1Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H32ClFN6O2/c1-18(28)26(37)35(16-22(36)14-31-33-30)24(27(2,3)4)25-32-23(20-11-8-12-21(29)13-20)17-34(25)15-19-9-6-5-7-10-19/h5-13,17-18,22,24,36H,14-16H2,1-4H3/t18?,22-,24+/m1/s1 |
| InChIKey | STPRUBUKHBTTHN-ZMOSESBSSA-N |
| XLogP | 5.95 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.04 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|