About 4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene
4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene (PubChem CID 59518913) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene.
Analyze 4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene?
The IUPAC name of 4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene (CID 59518913) is 4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene.
What is the SMILES notation for 4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene?
The canonical SMILES for 4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene is c1cc2c(cn1)C1CCCC2NC1.
What is the InChIKey of 4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene?
The InChIKey is POJJVIONLYILJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-2-8-6-13-11(3-1)9-4-5-12-7-10(8)9/h4-5,7-8,11,13H,1-3,6H2.
What are the key properties of 4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene?
4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene has a molecular weight of 174.25 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,13-diazatricyclo[6.3.2.02,7]trideca-2(7),3,5-triene is sourced from PubChem (CID 59518913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).