About 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene
10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene (PubChem CID 59518921) has the molecular formula C12H14S
and a molecular weight of 190.31 g/mol. Its IUPAC name is 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene.
Molecular Properties
| Compound Name | 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene |
| PubChem CID | 59518921 |
| Molecular Formula | C12H14S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene |
| SMILES | c1ccc2c(c1)C1CCC2CSC1 |
| InChI | InChI=1S/C12H14S/c1-2-4-12-10-6-5-9(7-13-8-10)11(12)3-1/h1-4,9-10H,5-8H2 |
| InChIKey | ICKDBGMGEIOHHA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene?
The IUPAC name of 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene (CID 59518921) is 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene.
What is the SMILES notation for 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene?
The canonical SMILES for 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene is c1ccc2c(c1)C1CCC2CSC1.
What is the InChIKey of 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene?
The InChIKey is ICKDBGMGEIOHHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14S/c1-2-4-12-10-6-5-9(7-13-8-10)11(12)3-1/h1-4,9-10H,5-8H2.
What are the key properties of 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene?
10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene has a molecular weight of 190.31 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-thiatricyclo[6.3.2.02,7]trideca-2,4,6-triene is sourced from PubChem (CID 59518921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).