About 3-ethoxyhexa-1,5-dienylbenzene
3-ethoxyhexa-1,5-dienylbenzene (PubChem CID 595191) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-ethoxyhexa-1,5-dienylbenzene.
Molecular Properties
| Compound Name | 3-ethoxyhexa-1,5-dienylbenzene |
| PubChem CID | 595191 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3-ethoxyhexa-1,5-dienylbenzene |
| SMILES | C=CCC(C=Cc1ccccc1)OCC |
| InChI | InChI=1S/C14H18O/c1-3-8-14(15-4-2)12-11-13-9-6-5-7-10-13/h3,5-7,9-12,14H,1,4,8H2,2H3 |
| InChIKey | WTTVTGXLZBPQGO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxyhexa-1,5-dienylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxyhexa-1,5-dienylbenzene?
The IUPAC name of 3-ethoxyhexa-1,5-dienylbenzene (CID 595191) is 3-ethoxyhexa-1,5-dienylbenzene.
What is the SMILES notation for 3-ethoxyhexa-1,5-dienylbenzene?
The canonical SMILES for 3-ethoxyhexa-1,5-dienylbenzene is C=CCC(C=Cc1ccccc1)OCC.
What is the InChIKey of 3-ethoxyhexa-1,5-dienylbenzene?
The InChIKey is WTTVTGXLZBPQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O/c1-3-8-14(15-4-2)12-11-13-9-6-5-7-10-13/h3,5-7,9-12,14H,1,4,8H2,2H3.
What are the key properties of 3-ethoxyhexa-1,5-dienylbenzene?
3-ethoxyhexa-1,5-dienylbenzene has a molecular weight of 202.30 g/mol, XLogP of 3.68, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxyhexa-1,5-dienylbenzene is sourced from PubChem (CID 595191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).