About 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde
2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde (PubChem CID 59519212) has the molecular formula C13H13N3OS
and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde |
| PubChem CID | 59519212 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde |
| SMILES | Cc1ccc(-c2[nH]c(N)nc(=S)c2C=O)c(C)c1 |
| InChI | InChI=1S/C13H13N3OS/c1-7-3-4-9(8(2)5-7)11-10(6-17)12(18)16-13(14)15-11/h3-6H,1-2H3,(H3,14,15,16,18) |
| InChIKey | QKUFXQOSRCUYKI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde?
The IUPAC name of 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde (CID 59519212) is 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde.
What is the SMILES notation for 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde?
The canonical SMILES for 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde is Cc1ccc(-c2[nH]c(N)nc(=S)c2C=O)c(C)c1.
What is the InChIKey of 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde?
The InChIKey is QKUFXQOSRCUYKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3OS/c1-7-3-4-9(8(2)5-7)11-10(6-17)12(18)16-13(14)15-11/h3-6H,1-2H3,(H3,14,15,16,18).
What are the key properties of 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde?
2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde has a molecular weight of 259.33 g/mol, XLogP of 2.82, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(2,4-dimethylphenyl)-4-sulfanylidene-1H-pyrimidine-5-carbaldehyde is sourced from PubChem (CID 59519212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).