C25H30ClFIN5O4SSi — CID 59519430
4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopropyl]sulfonyl-8-chloro-6-(2-fluoro-4-iodophenyl)-12-methyl-2,4,6,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),8,10-tetraen-5-one (PubChem CID 59519430) has the molecular formula C25H30ClFIN5O4SSi and a molecular weight of 706.05 g/mol. Its IUPAC name is 4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopropyl]sulfonyl-8-chloro-6-(2-fluoro-4-iodophenyl)-12-methyl-2,4,6,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),8,10-tetraen-5-one.
| Compound Name | 4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopropyl]sulfonyl-8-chloro-6-(2-fluoro-4-iodophenyl)-12-methyl-2,4,6,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),8,10-tetraen-5-one |
|---|---|
| PubChem CID | 59519430 |
| Molecular Formula | C25H30ClFIN5O4SSi |
| Molecular Weight | 706.05 g/mol |
| Exact Mass | 705.05 |
| IUPAC Name | 4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopropyl]sulfonyl-8-chloro-6-(2-fluoro-4-iodophenyl)-12-methyl-2,4,6,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),8,10-tetraen-5-one |
| SMILES | Cn1cnc2c(Cl)c3c(nc21)n(S(=O)(=O)C1(CCO[Si](C)(C)C(C)(C)C)CC1)c(=O)n3-c1ccc(I)cc1F |
| InChI | InChI=1S/C25H30ClFIN5O4SSi/c1-24(2,3)39(5,6)37-12-11-25(9-10-25)38(35,36)33-22-20(18(26)19-21(30-22)31(4)14-29-19)32(23(33)34)17-8-7-15(28)13-16(17)27/h7-8,13-14H,9-12H2,1-6H3 |
| InChIKey | YGOUGPABLWDEEU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 101.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.05 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|