C21H16F2IN3O4S — CID 59519475
8-fluoro-7-(2-fluoro-4-iodophenyl)-3-methyl-5-(1-prop-2-enylcyclopropyl)sulfonylimidazo[4,5-f][1,2]benzoxazol-6-one (PubChem CID 59519475) has the molecular formula C21H16F2IN3O4S and a molecular weight of 571.34 g/mol. Its IUPAC name is 8-fluoro-7-(2-fluoro-4-iodophenyl)-3-methyl-5-(1-prop-2-enylcyclopropyl)sulfonylimidazo[4,5-f][1,2]benzoxazol-6-one.
| Compound Name | 8-fluoro-7-(2-fluoro-4-iodophenyl)-3-methyl-5-(1-prop-2-enylcyclopropyl)sulfonylimidazo[4,5-f][1,2]benzoxazol-6-one |
|---|---|
| PubChem CID | 59519475 |
| Molecular Formula | C21H16F2IN3O4S |
| Molecular Weight | 571.34 g/mol |
| Exact Mass | 570.99 |
| IUPAC Name | 8-fluoro-7-(2-fluoro-4-iodophenyl)-3-methyl-5-(1-prop-2-enylcyclopropyl)sulfonylimidazo[4,5-f][1,2]benzoxazol-6-one |
| SMILES | C=CCC1(S(=O)(=O)n2c(=O)n(-c3ccc(I)cc3F)c3c(F)c4onc(C)c4cc32)CC1 |
| InChI | InChI=1S/C21H16F2IN3O4S/c1-3-6-21(7-8-21)32(29,30)27-16-10-13-11(2)25-31-19(13)17(23)18(16)26(20(27)28)15-5-4-12(24)9-14(15)22/h3-5,9-10H,1,6-8H2,2H3 |
| InChIKey | HGMJWEUNPCKZQB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 87.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|