About 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide
3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide (PubChem CID 59519616) has the molecular formula C8H14F2N2O2
and a molecular weight of 208.21 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide.
Molecular Properties
| Compound Name | 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide |
| PubChem CID | 59519616 |
| Molecular Formula | C8H14F2N2O2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide |
| SMILES | NC(CC(F)F)C(O)C(=O)NC1CC1 |
| InChI | InChI=1S/C8H14F2N2O2/c9-6(10)3-5(11)7(13)8(14)12-4-1-2-4/h4-7,13H,1-3,11H2,(H,12,14) |
| InChIKey | FVCMXDBMNCEMIE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide?
The IUPAC name of 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide (CID 59519616) is 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide.
What is the SMILES notation for 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide?
The canonical SMILES for 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide is NC(CC(F)F)C(O)C(=O)NC1CC1.
What is the InChIKey of 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide?
The InChIKey is FVCMXDBMNCEMIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O2/c9-6(10)3-5(11)7(13)8(14)12-4-1-2-4/h4-7,13H,1-3,11H2,(H,12,14).
What are the key properties of 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide?
3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide has a molecular weight of 208.21 g/mol, XLogP of -0.39, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-cyclopropyl-5,5-difluoro-2-hydroxypentanamide is sourced from PubChem (CID 59519616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).