About CID 59519849
CID 59519849 (PubChem CID 59519849) has the molecular formula C11H14BNO4
and a molecular weight of 235.05 g/mol.
Molecular Properties
| Compound Name | CID 59519849 |
| PubChem CID | 59519849 |
| Molecular Formula | C11H14BNO4 |
| Molecular Weight | 235.05 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1C[C@@H]2C(=O)CC[C@@H]2[C@H]1C(=O)OCC |
| InChI | InChI=1S/C11H14BNO4/c1-2-17-10(15)9-6-3-4-8(14)7(6)5-13(9)11(12)16/h6-7,9H,2-5H2,1H3/t6-,7-,9-/m0/s1 |
| InChIKey | VQPHXNPEEKJZAH-ZKWXMUAHSA-N |
| XLogP | 0.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.05 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59519849 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59519849?
The IUPAC name of CID 59519849 (CID 59519849) is not available.
What is the SMILES notation for CID 59519849?
The canonical SMILES for CID 59519849 is [B]C(=O)N1C[C@@H]2C(=O)CC[C@@H]2[C@H]1C(=O)OCC.
What is the InChIKey of CID 59519849?
The InChIKey is VQPHXNPEEKJZAH-ZKWXMUAHSA-N. The full InChI is InChI=1S/C11H14BNO4/c1-2-17-10(15)9-6-3-4-8(14)7(6)5-13(9)11(12)16/h6-7,9H,2-5H2,1H3/t6-,7-,9-/m0/s1.
What are the key properties of CID 59519849?
CID 59519849 has a molecular weight of 235.05 g/mol, XLogP of 0.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59519849 is sourced from PubChem (CID 59519849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).