C10H20N2O2S — CID 59520002
4-tert-butyl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 59520002) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 4-tert-butyl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | 4-tert-butyl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 59520002 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 4-tert-butyl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CC(C)(C)N1CCNC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C10H20N2O2S/c1-10(2,3)12-5-4-11-8-6-15(13,14)7-9(8)12/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | SHESWZLKWROSLU-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |