C11H21F3N2 — CID 59520016
1-tert-butyl-4-(3,3,3-trifluoropropyl)piperazine (PubChem CID 59520016) has the molecular formula C11H21F3N2 and a molecular weight of 238.30 g/mol. Its IUPAC name is 1-tert-butyl-4-(3,3,3-trifluoropropyl)piperazine.
| Compound Name | 1-tert-butyl-4-(3,3,3-trifluoropropyl)piperazine |
|---|---|
| PubChem CID | 59520016 |
| Molecular Formula | C11H21F3N2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-tert-butyl-4-(3,3,3-trifluoropropyl)piperazine |
| SMILES | CC(C)(C)N1CCN(CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H21F3N2/c1-10(2,3)16-8-6-15(7-9-16)5-4-11(12,13)14/h4-9H2,1-3H3 |
| InChIKey | WRUUBCICUDMRJB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |