About 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid
3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid (PubChem CID 59520141) has the molecular formula C17H15FN2O2S2
and a molecular weight of 362.45 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid |
| PubChem CID | 59520141 |
| Molecular Formula | C17H15FN2O2S2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1cccs1)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C17H15FN2O2S2/c18-13-5-3-12(4-6-13)15-11-24-17(19-15)20(8-7-16(21)22)10-14-2-1-9-23-14/h1-6,9,11H,7-8,10H2,(H,21,22) |
| InChIKey | JUGBZQDOJJKDFL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid?
The IUPAC name of 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid (CID 59520141) is 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid.
What is the SMILES notation for 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid?
The canonical SMILES for 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid is O=C(O)CCN(Cc1cccs1)c1nc(-c2ccc(F)cc2)cs1.
What is the InChIKey of 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid?
The InChIKey is JUGBZQDOJJKDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FN2O2S2/c18-13-5-3-12(4-6-13)15-11-24-17(19-15)20(8-7-16(21)22)10-14-2-1-9-23-14/h1-6,9,11H,7-8,10H2,(H,21,22).
What are the key properties of 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid?
3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid has a molecular weight of 362.45 g/mol, XLogP of 4.49, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-(thiophen-2-ylmethyl)amino]propanoic acid is sourced from PubChem (CID 59520141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).