About 3,3-dimethyl-1,4-dihydroquinoxalin-2-one
3,3-dimethyl-1,4-dihydroquinoxalin-2-one (PubChem CID 595203) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 3,3-dimethyl-1,4-dihydroquinoxalin-2-one.
Molecular Properties
| Compound Name | 3,3-dimethyl-1,4-dihydroquinoxalin-2-one |
| PubChem CID | 595203 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3,3-dimethyl-1,4-dihydroquinoxalin-2-one |
| SMILES | CC1(C)Nc2ccccc2NC1=O |
| InChI | InChI=1S/C10H12N2O/c1-10(2)9(13)11-7-5-3-4-6-8(7)12-10/h3-6,12H,1-2H3,(H,11,13) |
| InChIKey | RDKNTOVJVFYGPA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethyl-1,4-dihydroquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1,4-dihydroquinoxalin-2-one?
The IUPAC name of 3,3-dimethyl-1,4-dihydroquinoxalin-2-one (CID 595203) is 3,3-dimethyl-1,4-dihydroquinoxalin-2-one.
What is the SMILES notation for 3,3-dimethyl-1,4-dihydroquinoxalin-2-one?
The canonical SMILES for 3,3-dimethyl-1,4-dihydroquinoxalin-2-one is CC1(C)Nc2ccccc2NC1=O.
What is the InChIKey of 3,3-dimethyl-1,4-dihydroquinoxalin-2-one?
The InChIKey is RDKNTOVJVFYGPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-10(2)9(13)11-7-5-3-4-6-8(7)12-10/h3-6,12H,1-2H3,(H,11,13).
What are the key properties of 3,3-dimethyl-1,4-dihydroquinoxalin-2-one?
3,3-dimethyl-1,4-dihydroquinoxalin-2-one has a molecular weight of 176.22 g/mol, XLogP of 1.83, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1,4-dihydroquinoxalin-2-one is sourced from PubChem (CID 595203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).