C22H20Cl2N2O5 — CID 59520389
2-[3-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-ethyl-1,2-oxazol-3-yl]phenyl]acetic acid (PubChem CID 59520389) has the molecular formula C22H20Cl2N2O5 and a molecular weight of 463.32 g/mol. Its IUPAC name is 2-[3-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-ethyl-1,2-oxazol-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-ethyl-1,2-oxazol-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 59520389 |
| Molecular Formula | C22H20Cl2N2O5 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-[3-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-ethyl-1,2-oxazol-3-yl]phenyl]acetic acid |
| SMILES | CCc1onc(-c2cccc(CC(=O)O)c2)c1C(=O)NCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H20Cl2N2O5/c1-2-17-20(21(26-31-17)14-5-3-4-13(10-14)11-19(27)28)22(29)25-8-9-30-18-7-6-15(23)12-16(18)24/h3-7,10,12H,2,8-9,11H2,1H3,(H,25,29)(H,27,28) |
| InChIKey | VNRXJIKFEPCNQD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|