C23H27F3N4O4S2 — CID 59520491
N-(1,1-dioxothiolan-3-yl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 59520491) has the molecular formula C23H27F3N4O4S2 and a molecular weight of 544.62 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 59520491 |
| Molecular Formula | C23H27F3N4O4S2 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(Cn1nc(C(F)(F)F)c2c1CCCC2)Nc1sc2c(c1C(=O)NC1CCS(=O)(=O)C1)CCCC2 |
| InChI | InChI=1S/C23H27F3N4O4S2/c24-23(25,26)20-14-5-1-3-7-16(14)30(29-20)11-18(31)28-22-19(15-6-2-4-8-17(15)35-22)21(32)27-13-9-10-36(33,34)12-13/h13H,1-12H2,(H,27,32)(H,28,31) |
| InChIKey | UWAJSSNCWUPYDS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |