About N-nona-1,3,5,7-tetraynylacetamide
N-nona-1,3,5,7-tetraynylacetamide (PubChem CID 59520821) has the molecular formula C11H7NO
and a molecular weight of 169.18 g/mol. Its IUPAC name is N-nona-1,3,5,7-tetraynylacetamide.
Molecular Properties
| Compound Name | N-nona-1,3,5,7-tetraynylacetamide |
| PubChem CID | 59520821 |
| Molecular Formula | C11H7NO |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | N-nona-1,3,5,7-tetraynylacetamide |
| SMILES | CC#CC#CC#CC#CNC(C)=O |
| InChI | InChI=1S/C11H7NO/c1-3-4-5-6-7-8-9-10-12-11(2)13/h1-2H3,(H,12,13) |
| InChIKey | NNGXLOXJVDHVFM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-nona-1,3,5,7-tetraynylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-nona-1,3,5,7-tetraynylacetamide?
The IUPAC name of N-nona-1,3,5,7-tetraynylacetamide (CID 59520821) is N-nona-1,3,5,7-tetraynylacetamide.
What is the SMILES notation for N-nona-1,3,5,7-tetraynylacetamide?
The canonical SMILES for N-nona-1,3,5,7-tetraynylacetamide is CC#CC#CC#CC#CNC(C)=O.
What is the InChIKey of N-nona-1,3,5,7-tetraynylacetamide?
The InChIKey is NNGXLOXJVDHVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO/c1-3-4-5-6-7-8-9-10-12-11(2)13/h1-2H3,(H,12,13).
What are the key properties of N-nona-1,3,5,7-tetraynylacetamide?
N-nona-1,3,5,7-tetraynylacetamide has a molecular weight of 169.18 g/mol, XLogP of 0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-nona-1,3,5,7-tetraynylacetamide is sourced from PubChem (CID 59520821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).