About [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate
[(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate (PubChem CID 59520968) has the molecular formula C19H38O5
and a molecular weight of 346.51 g/mol. Its IUPAC name is [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate.
Molecular Properties
| Compound Name | [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate |
| PubChem CID | 59520968 |
| Molecular Formula | C19H38O5 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate |
| SMILES | CCCCCCCCCCCCCCC(=O)O[C@H](CO)COCO |
| InChI | InChI=1S/C19H38O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19(22)24-18(15-20)16-23-17-21/h18,20-21H,2-17H2,1H3/t18-/m1/s1 |
| InChIKey | LHNTUPDLDXSMSO-GOSISDBHSA-N |
| XLogP | 3.95 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate?
The IUPAC name of [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate (CID 59520968) is [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate.
What is the SMILES notation for [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate?
The canonical SMILES for [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate is CCCCCCCCCCCCCCC(=O)O[C@H](CO)COCO.
What is the InChIKey of [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate?
The InChIKey is LHNTUPDLDXSMSO-GOSISDBHSA-N. The full InChI is InChI=1S/C19H38O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19(22)24-18(15-20)16-23-17-21/h18,20-21H,2-17H2,1H3/t18-/m1/s1.
What are the key properties of [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate?
[(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate has a molecular weight of 346.51 g/mol, XLogP of 3.95, 18 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadecanoate is sourced from PubChem (CID 59520968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).